C40H73NO4 — CID 87287702
(Z)-2-(2-aminoethyl)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enoic acid (PubChem CID 87287702) has the molecular formula C40H73NO4 and a molecular weight of 632.03 g/mol. Its IUPAC name is (Z)-2-(2-aminoethyl)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enoic acid.
| Compound Name | (Z)-2-(2-aminoethyl)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enoic acid |
|---|---|
| PubChem CID | 87287702 |
| Molecular Formula | C40H73NO4 |
| Molecular Weight | 632.03 g/mol |
| Exact Mass | 631.55 |
| IUPAC Name | (Z)-2-(2-aminoethyl)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CCN)(C(=O)O)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H73NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(42)40(35-36-41,39(44)45)38(43)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36,41H2,1-2H3,(H,44,45)/b19-17-,20-18- |
| InChIKey | PMOMWKJCOPFPPL-CLFAGFIQSA-N |
| XLogP | 11.62 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.03 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|