C42H76N2O4 — CID 141037872
2,2-bis[(Z)-octadec-9-enoyl]hexanediamide (PubChem CID 141037872) has the molecular formula C42H76N2O4 and a molecular weight of 673.08 g/mol. Its IUPAC name is 2,2-bis[(Z)-octadec-9-enoyl]hexanediamide.
| Compound Name | 2,2-bis[(Z)-octadec-9-enoyl]hexanediamide |
|---|---|
| PubChem CID | 141037872 |
| Molecular Formula | C42H76N2O4 |
| Molecular Weight | 673.08 g/mol |
| Exact Mass | 672.58 |
| IUPAC Name | 2,2-bis[(Z)-octadec-9-enoyl]hexanediamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CCCC(N)=O)(C(N)=O)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H76N2O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-38(45)42(41(44)48,37-33-36-40(43)47)39(46)35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-37H2,1-2H3,(H2,43,47)(H2,44,48)/b19-17-,20-18- |
| InChIKey | LUGDJDOAFXOEON-CLFAGFIQSA-N |
| XLogP | 11.33 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.08 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|