C20H41NO5S — CID 174421600
2-hydroxyethanesulfonic acid;(Z)-octadec-9-enamide (PubChem CID 174421600) has the molecular formula C20H41NO5S and a molecular weight of 407.62 g/mol. Its IUPAC name is 2-hydroxyethanesulfonic acid;(Z)-octadec-9-enamide.
| Compound Name | 2-hydroxyethanesulfonic acid;(Z)-octadec-9-enamide |
|---|---|
| PubChem CID | 174421600 |
| Molecular Formula | C20H41NO5S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 2-hydroxyethanesulfonic acid;(Z)-octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.O=S(=O)(O)CCO |
| InChI | InChI=1S/C18H35NO.C2H6O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-1-2-7(4,5)6/h9-10H,2-8,11-17H2,1H3,(H2,19,20);3H,1-2H2,(H,4,5,6)/b10-9-; |
| InChIKey | WITVPWHXROEXCO-KVVVOXFISA-N |
| XLogP | 4.38 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|