About zinc;2-hydroxypropanoate;sulfate
zinc;2-hydroxypropanoate;sulfate (PubChem CID 86732976) has the molecular formula C3H5O7SZn-
and a molecular weight of 250.52 g/mol. Its IUPAC name is zinc;2-hydroxypropanoate;sulfate.
Molecular Properties
| Compound Name | zinc;2-hydroxypropanoate;sulfate |
| PubChem CID | 86732976 |
| Molecular Formula | C3H5O7SZn- |
| Molecular Weight | 250.52 g/mol |
| Exact Mass | 248.91 |
| IUPAC Name | zinc;2-hydroxypropanoate;sulfate |
| SMILES | CC(O)C(=O)[O-].O=S(=O)([O-])[O-].[Zn+2] |
| InChI | InChI=1S/C3H6O3.H2O4S.Zn/c1-2(4)3(5)6;1-5(2,3)4;/h2,4H,1H3,(H,5,6);(H2,1,2,3,4);/q;;+2/p-3 |
| InChIKey | VCXJRYJJHXEEMJ-UHFFFAOYSA-K |
| XLogP | -3.22 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.52 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-hydroxypropanoate;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-hydroxypropanoate;sulfate?
The IUPAC name of zinc;2-hydroxypropanoate;sulfate (CID 86732976) is zinc;2-hydroxypropanoate;sulfate.
What is the SMILES notation for zinc;2-hydroxypropanoate;sulfate?
The canonical SMILES for zinc;2-hydroxypropanoate;sulfate is CC(O)C(=O)[O-].O=S(=O)([O-])[O-].[Zn+2].
What is the InChIKey of zinc;2-hydroxypropanoate;sulfate?
The InChIKey is VCXJRYJJHXEEMJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H6O3.H2O4S.Zn/c1-2(4)3(5)6;1-5(2,3)4;/h2,4H,1H3,(H,5,6);(H2,1,2,3,4);/q;;+2/p-3.
What are the key properties of zinc;2-hydroxypropanoate;sulfate?
zinc;2-hydroxypropanoate;sulfate has a molecular weight of 250.52 g/mol, XLogP of -3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-hydroxypropanoate;sulfate is sourced from PubChem (CID 86732976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).