C6H12O3 — CID 13081578
1,4-dihydroxy-3-methylpentan-2-one (PubChem CID 13081578) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 1,4-dihydroxy-3-methylpentan-2-one.
| Compound Name | 1,4-dihydroxy-3-methylpentan-2-one |
|---|---|
| PubChem CID | 13081578 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 1,4-dihydroxy-3-methylpentan-2-one |
| SMILES | CC(O)C(C)C(=O)CO |
| InChI | InChI=1S/C6H12O3/c1-4(5(2)8)6(9)3-7/h4-5,7-8H,3H2,1-2H3 |
| InChIKey | UAFCVHAXODPLTF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |