C10H19NO6 — CID 54281179
3-hydroxy-N-[(3R,4R,5R)-1,4,5-trihydroxy-2-oxohexan-3-yl]butanamide (PubChem CID 54281179) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is 3-hydroxy-N-[(3R,4R,5R)-1,4,5-trihydroxy-2-oxohexan-3-yl]butanamide.
| Compound Name | 3-hydroxy-N-[(3R,4R,5R)-1,4,5-trihydroxy-2-oxohexan-3-yl]butanamide |
|---|---|
| PubChem CID | 54281179 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-hydroxy-N-[(3R,4R,5R)-1,4,5-trihydroxy-2-oxohexan-3-yl]butanamide |
| SMILES | CC(O)CC(=O)N[C@@H](C(=O)CO)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C10H19NO6/c1-5(13)3-8(16)11-9(7(15)4-12)10(17)6(2)14/h5-6,9-10,12-14,17H,3-4H2,1-2H3,(H,11,16)/t5?,6-,9+,10+/m1/s1 |
| InChIKey | RQWVADCDSCRBAL-ORPLZSCASA-N |
| XLogP | -2.45 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |