C10H17NO7 — CID 171378058
N-[(4R,5R,6S)-5,6,7,8-tetrahydroxy-2,3-dioxooctan-4-yl]acetamide (PubChem CID 171378058) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is N-[(4R,5R,6S)-5,6,7,8-tetrahydroxy-2,3-dioxooctan-4-yl]acetamide.
| Compound Name | N-[(4R,5R,6S)-5,6,7,8-tetrahydroxy-2,3-dioxooctan-4-yl]acetamide |
|---|---|
| PubChem CID | 171378058 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-[(4R,5R,6S)-5,6,7,8-tetrahydroxy-2,3-dioxooctan-4-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C(=O)C(C)=O)[C@@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C10H17NO7/c1-4(13)8(16)7(11-5(2)14)10(18)9(17)6(15)3-12/h6-7,9-10,12,15,17-18H,3H2,1-2H3,(H,11,14)/t6?,7-,9+,10+/m0/s1 |
| InChIKey | UTAPKFZYGKIFPA-ZGFSTQBOSA-N |
| XLogP | -3.28 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|