C11H21NO9 — CID 15548827
(2S,4S,5R,6R,7R,8R)-5-acetamido-2,4,6,7,8,9-hexahydroxynonanoic acid (PubChem CID 15548827) has the molecular formula C11H21NO9 and a molecular weight of 311.29 g/mol. Its IUPAC name is (2S,4S,5R,6R,7R,8R)-5-acetamido-2,4,6,7,8,9-hexahydroxynonanoic acid.
| Compound Name | (2S,4S,5R,6R,7R,8R)-5-acetamido-2,4,6,7,8,9-hexahydroxynonanoic acid |
|---|---|
| PubChem CID | 15548827 |
| Molecular Formula | C11H21NO9 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S,4S,5R,6R,7R,8R)-5-acetamido-2,4,6,7,8,9-hexahydroxynonanoic acid |
| SMILES | CC(=O)N[C@@H]([C@@H](O)[C@@H](O)[C@H](O)CO)[C@@H](O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C11H21NO9/c1-4(14)12-8(5(15)2-6(16)11(20)21)10(19)9(18)7(17)3-13/h5-10,13,15-19H,2-3H2,1H3,(H,12,14)(H,20,21)/t5-,6-,7+,8+,9-,10+/m0/s1 |
| InChIKey | REORMAHRVILHOU-AZDAQJLHSA-N |
| XLogP | -4.24 |
| TPSA | 187.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |