C15H28N2O12 — CID 87655537
(4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxononanoic acid;2-amino-3-hydroxybutanoic acid (PubChem CID 87655537) has the molecular formula C15H28N2O12 and a molecular weight of 428.39 g/mol. Its IUPAC name is (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxononanoic acid;2-amino-3-hydroxybutanoic acid.
| Compound Name | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxononanoic acid;2-amino-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 87655537 |
| Molecular Formula | C15H28N2O12 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxononanoic acid;2-amino-3-hydroxybutanoic acid |
| SMILES | CC(=O)N[C@@H]([C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)CC(=O)C(=O)O.CC(O)C(N)C(=O)O |
| InChI | InChI=1S/C11H19NO9.C4H9NO3/c1-4(14)12-8(5(15)2-6(16)11(20)21)10(19)9(18)7(17)3-13;1-2(6)3(5)4(7)8/h5,7-10,13,15,17-19H,2-3H2,1H3,(H,12,14)(H,20,21);2-3,6H,5H2,1H3,(H,7,8)/t5-,7+,8+,9+,10+;/m0./s1 |
| InChIKey | BTHNFGJEKBEFAZ-CBSHMQKXSA-N |
| XLogP | -5.25 |
| TPSA | 268.17 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | -5.25 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|