C13H23NO9 — CID 100931509
(4S,5R,6R,7S,8R)-5-(butanoylamino)-4,6,7,8,9-pentahydroxy-2-oxononanoic acid (PubChem CID 100931509) has the molecular formula C13H23NO9 and a molecular weight of 337.33 g/mol. Its IUPAC name is (4S,5R,6R,7S,8R)-5-(butanoylamino)-4,6,7,8,9-pentahydroxy-2-oxononanoic acid.
| Compound Name | (4S,5R,6R,7S,8R)-5-(butanoylamino)-4,6,7,8,9-pentahydroxy-2-oxononanoic acid |
|---|---|
| PubChem CID | 100931509 |
| Molecular Formula | C13H23NO9 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (4S,5R,6R,7S,8R)-5-(butanoylamino)-4,6,7,8,9-pentahydroxy-2-oxononanoic acid |
| SMILES | CCCC(=O)N[C@@H]([C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C13H23NO9/c1-2-3-9(19)14-10(6(16)4-7(17)13(22)23)12(21)11(20)8(18)5-15/h6,8,10-12,15-16,18,20-21H,2-5H2,1H3,(H,14,19)(H,22,23)/t6-,8+,10+,11+,12+/m0/s1 |
| InChIKey | PLJCRTKLLRMFCQ-ZNKBUBFTSA-N |
| XLogP | -3.25 |
| TPSA | 184.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|