C14H23NO11 — CID 140685415
(4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8-tetrahydroxy-9-(2-hydroxypropanoyloxy)-2-oxononanoic acid (PubChem CID 140685415) has the molecular formula C14H23NO11 and a molecular weight of 381.33 g/mol. Its IUPAC name is (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8-tetrahydroxy-9-(2-hydroxypropanoyloxy)-2-oxononanoic acid.
| Compound Name | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8-tetrahydroxy-9-(2-hydroxypropanoyloxy)-2-oxononanoic acid |
|---|---|
| PubChem CID | 140685415 |
| Molecular Formula | C14H23NO11 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8-tetrahydroxy-9-(2-hydroxypropanoyloxy)-2-oxononanoic acid |
| SMILES | CC(=O)N[C@@H]([C@@H](O)[C@H](O)[C@H](O)COC(=O)C(C)O)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C14H23NO11/c1-5(16)14(25)26-4-9(20)11(21)12(22)10(15-6(2)17)7(18)3-8(19)13(23)24/h5,7,9-12,16,18,20-22H,3-4H2,1-2H3,(H,15,17)(H,23,24)/t5?,7-,9+,10+,11+,12+/m0/s1 |
| InChIKey | FCRQMQAEQSGJHM-KSKMMIOASA-N |
| XLogP | -4.10 |
| TPSA | 210.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|