C12H21NO9 — CID 59366497
(5S,6S)-5-acetamido-6,7,8,9-tetrahydroxy-4-methoxy-2-oxononanoic acid (PubChem CID 59366497) has the molecular formula C12H21NO9 and a molecular weight of 323.30 g/mol. Its IUPAC name is (5S,6S)-5-acetamido-6,7,8,9-tetrahydroxy-4-methoxy-2-oxononanoic acid.
| Compound Name | (5S,6S)-5-acetamido-6,7,8,9-tetrahydroxy-4-methoxy-2-oxononanoic acid |
|---|---|
| PubChem CID | 59366497 |
| Molecular Formula | C12H21NO9 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (5S,6S)-5-acetamido-6,7,8,9-tetrahydroxy-4-methoxy-2-oxononanoic acid |
| SMILES | COC(CC(=O)C(=O)O)[C@@H](NC(C)=O)[C@H](O)C(O)C(O)CO |
| InChI | InChI=1S/C12H21NO9/c1-5(15)13-9(11(19)10(18)7(17)4-14)8(22-2)3-6(16)12(20)21/h7-11,14,17-19H,3-4H2,1-2H3,(H,13,15)(H,20,21)/t7?,8?,9-,10?,11+/m1/s1 |
| InChIKey | UWTCTIMOBMXPCE-SDBDODODSA-N |
| XLogP | -3.38 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|