C8H16N2O7 — CID 125027865
N-[(2R,3S,4S,5S)-3,4,5,6-tetrahydroxy-1-nitrohexan-2-yl]acetamide (PubChem CID 125027865) has the molecular formula C8H16N2O7 and a molecular weight of 252.22 g/mol. Its IUPAC name is N-[(2R,3S,4S,5S)-3,4,5,6-tetrahydroxy-1-nitrohexan-2-yl]acetamide.
| Compound Name | N-[(2R,3S,4S,5S)-3,4,5,6-tetrahydroxy-1-nitrohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 125027865 |
| Molecular Formula | C8H16N2O7 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-[(2R,3S,4S,5S)-3,4,5,6-tetrahydroxy-1-nitrohexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C[N+](=O)[O-])[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C8H16N2O7/c1-4(12)9-5(2-10(16)17)7(14)8(15)6(13)3-11/h5-8,11,13-15H,2-3H2,1H3,(H,9,12)/t5-,6+,7+,8-/m1/s1 |
| InChIKey | GTLVBKOTJMCFBC-VGRMVHKJSA-N |
| XLogP | -3.16 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|