C7H13O9P — CID 101011936
[(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate (PubChem CID 101011936) has the molecular formula C7H13O9P and a molecular weight of 272.15 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate.
| Compound Name | [(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101011936 |
| Molecular Formula | C7H13O9P |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate |
| SMILES | CC(=O)[C@H]1O[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13O9P/c1-2(8)6-4(10)3(9)5(11)7(15-6)16-17(12,13)14/h3-7,9-11H,1H3,(H2,12,13,14)/t3-,4-,5+,6+,7-/m0/s1 |
| InChIKey | YIUYKZBLYHCVNV-TYDWOXHJSA-N |
| XLogP | -2.51 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|