C15H31N2O9P — CID 153301811
2-[[(3S,4R,5R)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carbonyl]amino]ethoxy-[2-(trimethylazaniumyl)ethyl]phosphinate (PubChem CID 153301811) has the molecular formula C15H31N2O9P and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-[[(3S,4R,5R)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carbonyl]amino]ethoxy-[2-(trimethylazaniumyl)ethyl]phosphinate.
| Compound Name | 2-[[(3S,4R,5R)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carbonyl]amino]ethoxy-[2-(trimethylazaniumyl)ethyl]phosphinate |
|---|---|
| PubChem CID | 153301811 |
| Molecular Formula | C15H31N2O9P |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[[(3S,4R,5R)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carbonyl]amino]ethoxy-[2-(trimethylazaniumyl)ethyl]phosphinate |
| SMILES | COC1OC(C(=O)NCCOP(=O)([O-])CC[N+](C)(C)C)[C@@H](OC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H31N2O9P/c1-17(2,3)7-9-27(21,22)25-8-6-16-14(20)13-12(23-4)10(18)11(19)15(24-5)26-13/h10-13,15,18-19H,6-9H2,1-5H3,(H-,16,20,21,22)/t10-,11-,12+,13?,15?/m1/s1 |
| InChIKey | JLDMCZCQSFAJEW-BIEYCCQWSA-N |
| XLogP | -2.51 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|