C22H36N2O16S — CID 155602354
(2R,3S)-6-[(3S,5S,6R)-2-carboxy-4-hydroxy-6-methoxy-5-[2-[2-(3-sulfanylpropanoylamino)ethoxy]ethylcarbamoyloxy]oxan-3-yl]oxy-4,5-dihydroxy-3-methoxyoxane-2-carboxylic acid (PubChem CID 155602354) has the molecular formula C22H36N2O16S and a molecular weight of 616.59 g/mol. Its IUPAC name is (2R,3S)-6-[(3S,5S,6R)-2-carboxy-4-hydroxy-6-methoxy-5-[2-[2-(3-sulfanylpropanoylamino)ethoxy]ethylcarbamoyloxy]oxan-3-yl]oxy-4,5-dihydroxy-3-methoxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S)-6-[(3S,5S,6R)-2-carboxy-4-hydroxy-6-methoxy-5-[2-[2-(3-sulfanylpropanoylamino)ethoxy]ethylcarbamoyloxy]oxan-3-yl]oxy-4,5-dihydroxy-3-methoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 155602354 |
| Molecular Formula | C22H36N2O16S |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | (2R,3S)-6-[(3S,5S,6R)-2-carboxy-4-hydroxy-6-methoxy-5-[2-[2-(3-sulfanylpropanoylamino)ethoxy]ethylcarbamoyloxy]oxan-3-yl]oxy-4,5-dihydroxy-3-methoxyoxane-2-carboxylic acid |
| SMILES | CO[C@@H]1OC(C(=O)O)[C@@H](OC2O[C@@H](C(=O)O)[C@@H](OC)C(O)C2O)C(O)[C@@H]1OC(=O)NCCOCCNC(=O)CCS |
| InChI | InChI=1S/C22H36N2O16S/c1-34-13-10(26)11(27)20(38-16(13)18(29)30)37-14-12(28)15(21(35-2)39-17(14)19(31)32)40-22(33)24-5-7-36-6-4-23-9(25)3-8-41/h10-17,20-21,26-28,41H,3-8H2,1-2H3,(H,23,25)(H,24,33)(H,29,30)(H,31,32)/t10?,11?,12?,13-,14-,15-,16+,17?,20?,21+/m0/s1 |
| InChIKey | MVPDVEABDNAAHL-NKJYGXTOSA-N |
| XLogP | -3.72 |
| TPSA | 258.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|