C7H12O7S — CID 123435417
3,4,5-trihydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid (PubChem CID 123435417) has the molecular formula C7H12O7S and a molecular weight of 240.23 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 123435417 |
| Molecular Formula | C7H12O7S |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3,4,5-trihydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid |
| SMILES | CSOC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C7H12O7S/c1-15-14-7-4(10)2(8)3(9)5(13-7)6(11)12/h2-5,7-10H,1H3,(H,11,12) |
| InChIKey | SPMHWCCLBFXURX-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|