C6H14O11P2 — CID 87650942
[(3R,4R,5S)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl] phosphono hydrogen phosphate (PubChem CID 87650942) has the molecular formula C6H14O11P2 and a molecular weight of 324.12 g/mol. Its IUPAC name is [(3R,4R,5S)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl] phosphono hydrogen phosphate.
| Compound Name | [(3R,4R,5S)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87650942 |
| Molecular Formula | C6H14O11P2 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | [(3R,4R,5S)-3,4-dihydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl] phosphono hydrogen phosphate |
| SMILES | C[C@@H](O)[C@@H]1OC(OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14O11P2/c1-2(7)5-3(8)4(9)6(15-5)16-19(13,14)17-18(10,11)12/h2-9H,1H3,(H,13,14)(H2,10,11,12)/t2-,3-,4-,5+,6?/m1/s1 |
| InChIKey | WBPGSQHEVHJRBL-RSVSWTKNSA-N |
| XLogP | -1.96 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|