C6H12N3O8P — CID 91109049
[(2R,3R,4S,5S,6S)-5-azido-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate (PubChem CID 91109049) has the molecular formula C6H12N3O8P and a molecular weight of 285.15 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-5-azido-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5S,6S)-5-azido-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91109049 |
| Molecular Formula | C6H12N3O8P |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-5-azido-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)O[C@@H]1CO |
| InChI | InChI=1S/C6H12N3O8P/c7-9-8-3-2(1-10)16-6(5(12)4(3)11)17-18(13,14)15/h2-6,10-12H,1H2,(H2,13,14,15)/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | DCLKEWOLRHGVST-VFUOTHLCSA-N |
| XLogP | -1.79 |
| TPSA | 185.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|