C13H23N7O3 — CID 25215650
tert-butyl N-[(4R,5R)-4,5-bis(azidomethyl)-2-hydroxycyclohexyl]carbamate (PubChem CID 25215650) has the molecular formula C13H23N7O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is tert-butyl N-[(4R,5R)-4,5-bis(azidomethyl)-2-hydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(4R,5R)-4,5-bis(azidomethyl)-2-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 25215650 |
| Molecular Formula | C13H23N7O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl N-[(4R,5R)-4,5-bis(azidomethyl)-2-hydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C[C@@H](CN=[N+]=[N-])[C@H](CN=[N+]=[N-])CC1O |
| InChI | InChI=1S/C13H23N7O3/c1-13(2,3)23-12(22)18-10-4-8(6-16-19-14)9(5-11(10)21)7-17-20-15/h8-11,21H,4-7H2,1-3H3,(H,18,22)/t8-,9-,10?,11?/m0/s1 |
| InChIKey | YSINRKLBKKROLI-SAAXCQNUSA-N |
| XLogP | 2.89 |
| TPSA | 156.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|