C9H15N5O3 — CID 86734331
tert-butyl N-[(2S,3R)-2-(azidomethyl)-4-oxoazetidin-3-yl]carbamate (PubChem CID 86734331) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-2-(azidomethyl)-4-oxoazetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-2-(azidomethyl)-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86734331 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | tert-butyl N-[(2S,3R)-2-(azidomethyl)-4-oxoazetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C(=O)N[C@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C9H15N5O3/c1-9(2,3)17-8(16)13-6-5(4-11-14-10)12-7(6)15/h5-6H,4H2,1-3H3,(H,12,15)(H,13,16)/t5-,6+/m0/s1 |
| InChIKey | WIRMMOMBYCGBPM-NTSWFWBYSA-N |
| XLogP | 0.69 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|