C16H24N8O5S — CID 146444442
(2S,5R,6R)-2-(1,3-diazidopropan-2-yl)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 146444442) has the molecular formula C16H24N8O5S and a molecular weight of 440.49 g/mol. Its IUPAC name is (2S,5R,6R)-2-(1,3-diazidopropan-2-yl)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-2-(1,3-diazidopropan-2-yl)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 146444442 |
| Molecular Formula | C16H24N8O5S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2S,5R,6R)-2-(1,3-diazidopropan-2-yl)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@]2(C(=O)O)C(CN=[N+]=[N-])CN=[N+]=[N-] |
| InChI | InChI=1S/C16H24N8O5S/c1-14(2,3)29-13(28)21-9-10(25)24-11(9)30-15(4,5)16(24,12(26)27)8(6-19-22-17)7-20-23-18/h8-9,11H,6-7H2,1-5H3,(H,21,28)(H,26,27)/t9-,11-,16+/m1/s1 |
| InChIKey | KJQXNHOYGOQBQY-RDGWCUKFSA-N |
| XLogP | 2.63 |
| TPSA | 193.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|