C15H22N8O5S — CID 146477301
[1,3-diazido-1-[(6R)-3-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propan-2-yl] formate (PubChem CID 146477301) has the molecular formula C15H22N8O5S and a molecular weight of 426.46 g/mol. Its IUPAC name is [1,3-diazido-1-[(6R)-3-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propan-2-yl] formate.
| Compound Name | [1,3-diazido-1-[(6R)-3-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propan-2-yl] formate |
|---|---|
| PubChem CID | 146477301 |
| Molecular Formula | C15H22N8O5S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [1,3-diazido-1-[(6R)-3-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]propan-2-yl] formate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C(=O)N2CC(C)(C(N=[N+]=[N-])C(CN=[N+]=[N-])OC=O)SC12 |
| InChI | InChI=1S/C15H22N8O5S/c1-14(2,3)28-13(26)19-9-11(25)23-6-15(4,29-12(9)23)10(20-22-17)8(27-7-24)5-18-21-16/h7-10,12H,5-6H2,1-4H3,(H,19,26)/t8?,9-,10?,12?,15?/m1/s1 |
| InChIKey | LZGJRHLYCTYQEX-VZWSTBSISA-N |
| XLogP | 2.08 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|