C11H18N2O4 — CID 131076113
tert-butyl N-[(2R,3S)-2-ethyl-1-formyl-4-oxoazetidin-3-yl]carbamate (PubChem CID 131076113) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-2-ethyl-1-formyl-4-oxoazetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-2-ethyl-1-formyl-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 131076113 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | tert-butyl N-[(2R,3S)-2-ethyl-1-formyl-4-oxoazetidin-3-yl]carbamate |
| SMILES | CC[C@@H]1[C@H](NC(=O)OC(C)(C)C)C(=O)N1C=O |
| InChI | InChI=1S/C11H18N2O4/c1-5-7-8(9(15)13(7)6-14)12-10(16)17-11(2,3)4/h6-8H,5H2,1-4H3,(H,12,16)/t7-,8+/m1/s1 |
| InChIKey | DHLVSYRADZSKEQ-SFYZADRCSA-N |
| XLogP | 0.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|