C12H20N2O3 — CID 73110709
tert-butyl N-(2-methyl-4-oxo-1-prop-2-enylazetidin-3-yl)carbamate (PubChem CID 73110709) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-4-oxo-1-prop-2-enylazetidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-4-oxo-1-prop-2-enylazetidin-3-yl)carbamate |
|---|---|
| PubChem CID | 73110709 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl N-(2-methyl-4-oxo-1-prop-2-enylazetidin-3-yl)carbamate |
| SMILES | C=CCN1C(=O)C(NC(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C12H20N2O3/c1-6-7-14-8(2)9(10(14)15)13-11(16)17-12(3,4)5/h6,8-9H,1,7H2,2-5H3,(H,13,16) |
| InChIKey | SKOZQTFFZVBZQN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|