C10H18N2O6P- — CID 131713942
methoxy-[(2S,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]phosphinate (PubChem CID 131713942) has the molecular formula C10H18N2O6P- and a molecular weight of 293.24 g/mol. Its IUPAC name is methoxy-[(2S,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]phosphinate.
| Compound Name | methoxy-[(2S,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]phosphinate |
|---|---|
| PubChem CID | 131713942 |
| Molecular Formula | C10H18N2O6P- |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | methoxy-[(2S,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]phosphinate |
| SMILES | COP(=O)([O-])N1C(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C10H19N2O6P/c1-6-7(11-9(14)18-10(2,3)4)8(13)12(6)19(15,16)17-5/h6-7H,1-5H3,(H,11,14)(H,15,16)/p-1/t6-,7-/m0/s1 |
| InChIKey | WZUDHPVAPBJEND-BQBZGAKWSA-M |
| XLogP | 0.23 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|