C14H19N3O6S — CID 70343880
(3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-(pyridin-1-ium-1-ylmethyl)azetidine-1-sulfonate (PubChem CID 70343880) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is (3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-(pyridin-1-ium-1-ylmethyl)azetidine-1-sulfonate.
| Compound Name | (3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-(pyridin-1-ium-1-ylmethyl)azetidine-1-sulfonate |
|---|---|
| PubChem CID | 70343880 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-(pyridin-1-ium-1-ylmethyl)azetidine-1-sulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C(=O)N(S(=O)(=O)[O-])[C@H]1C[n+]1ccccc1 |
| InChI | InChI=1S/C14H19N3O6S/c1-14(2,3)23-13(19)15-11-10(9-16-7-5-4-6-8-16)17(12(11)18)24(20,21)22/h4-8,10-11H,9H2,1-3H3,(H-,15,19,20,21,22)/t10-,11+/m0/s1 |
| InChIKey | VGACFTRKUHJNAM-WDEREUQCSA-N |
| XLogP | -0.46 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|