C14H23NO5 — CID 118425564
tert-butyl N-[(2R,4S,5S)-2-but-3-enyl-4-methyl-6-oxo-1,3-dioxan-5-yl]carbamate (PubChem CID 118425564) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl N-[(2R,4S,5S)-2-but-3-enyl-4-methyl-6-oxo-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4S,5S)-2-but-3-enyl-4-methyl-6-oxo-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 118425564 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl N-[(2R,4S,5S)-2-but-3-enyl-4-methyl-6-oxo-1,3-dioxan-5-yl]carbamate |
| SMILES | C=CCC[C@H]1OC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@H](C)O1 |
| InChI | InChI=1S/C14H23NO5/c1-6-7-8-10-18-9(2)11(12(16)19-10)15-13(17)20-14(3,4)5/h6,9-11H,1,7-8H2,2-5H3,(H,15,17)/t9-,10+,11-/m0/s1 |
| InChIKey | NROUZQAITSUBAT-AXFHLTTASA-N |
| XLogP | 2.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|