C10H17NO3 — CID 100948093
tert-butyl N-[[(2R,3S)-3-ethenyloxiran-2-yl]methyl]carbamate (PubChem CID 100948093) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl N-[[(2R,3S)-3-ethenyloxiran-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2R,3S)-3-ethenyloxiran-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 100948093 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | tert-butyl N-[[(2R,3S)-3-ethenyloxiran-2-yl]methyl]carbamate |
| SMILES | C=C[C@@H]1O[C@@H]1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO3/c1-5-7-8(13-7)6-11-9(12)14-10(2,3)4/h5,7-8H,1,6H2,2-4H3,(H,11,12)/t7-,8+/m0/s1 |
| InChIKey | TXDUCSVDYDWUOQ-JGVFFNPUSA-N |
| XLogP | 1.46 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|