C11H22N2O2 — CID 45092197
tert-butyl N-[(3S)-4,4-dimethylpyrrolidin-3-yl]carbamate (PubChem CID 45092197) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4,4-dimethylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4,4-dimethylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 45092197 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | tert-butyl N-[(3S)-4,4-dimethylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNCC1(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-10(2,3)15-9(14)13-8-6-12-7-11(8,4)5/h8,12H,6-7H2,1-5H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | SRIANBFFCCZBBZ-MRVPVSSYSA-N |
| XLogP | 1.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |