C10H18F2N2O2 — CID 97291627
tert-butyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate (PubChem CID 97291627) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 97291627 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | tert-butyl N-[(3R)-5,5-difluoropiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNCC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2O2/c1-9(2,3)16-8(15)14-7-4-10(11,12)6-13-5-7/h7,13H,4-6H2,1-3H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | NZEASWFMIYVAAZ-SSDOTTSWSA-N |
| XLogP | 1.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |