C13H20FNO2 — CID 123740466
tert-butyl N-(2-fluoro-2-penta-2,4-dien-2-ylcyclopropyl)carbamate (PubChem CID 123740466) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is tert-butyl N-(2-fluoro-2-penta-2,4-dien-2-ylcyclopropyl)carbamate.
| Compound Name | tert-butyl N-(2-fluoro-2-penta-2,4-dien-2-ylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 123740466 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | tert-butyl N-(2-fluoro-2-penta-2,4-dien-2-ylcyclopropyl)carbamate |
| SMILES | C=CC=C(C)C1(F)CC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20FNO2/c1-6-7-9(2)13(14)8-10(13)15-11(16)17-12(3,4)5/h6-7,10H,1,8H2,2-5H3,(H,15,16) |
| InChIKey | UZRQVCFQPYMPQO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|