C10H17NO4 — CID 59351920
tert-butyl N-[2-hydroxy-2-(oxiran-2-yl)cyclopropyl]carbamate (PubChem CID 59351920) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-2-(oxiran-2-yl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-2-(oxiran-2-yl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 59351920 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | tert-butyl N-[2-hydroxy-2-(oxiran-2-yl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1(O)C1CO1 |
| InChI | InChI=1S/C10H17NO4/c1-9(2,3)15-8(12)11-6-4-10(6,13)7-5-14-7/h6-7,13H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | FGMJLOQYUIUYDS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|