C10H19NO4 — CID 157038702
tert-butyl N-[(3R,4S)-4-hydroxy-4-methyloxolan-3-yl]carbamate (PubChem CID 157038702) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-4-hydroxy-4-methyloxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-4-hydroxy-4-methyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 157038702 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | tert-butyl N-[(3R,4S)-4-hydroxy-4-methyloxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@@]1(C)O |
| InChI | InChI=1S/C10H19NO4/c1-9(2,3)15-8(12)11-7-5-14-6-10(7,4)13/h7,13H,5-6H2,1-4H3,(H,11,12)/t7-,10-/m1/s1 |
| InChIKey | ZXCOESHIOKPIFY-GMSGAONNSA-N |
| XLogP | 0.66 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |