C11H20O4 — CID 161354279
tert-butyl 2-[(4S)-4-hydroxy-4-methyloxolan-3-yl]acetate (PubChem CID 161354279) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl 2-[(4S)-4-hydroxy-4-methyloxolan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(4S)-4-hydroxy-4-methyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 161354279 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | tert-butyl 2-[(4S)-4-hydroxy-4-methyloxolan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1COC[C@@]1(C)O |
| InChI | InChI=1S/C11H20O4/c1-10(2,3)15-9(12)5-8-6-14-7-11(8,4)13/h8,13H,5-7H2,1-4H3/t8?,11-/m1/s1 |
| InChIKey | LRADSQDNBRDVLB-QHDYGNBISA-N |
| XLogP | 1.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |