C14H26O5S — CID 91330362
1-[(1R,3R)-2,2-dimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutyl]ethanesulfonic acid (PubChem CID 91330362) has the molecular formula C14H26O5S and a molecular weight of 306.42 g/mol. Its IUPAC name is 1-[(1R,3R)-2,2-dimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutyl]ethanesulfonic acid.
| Compound Name | 1-[(1R,3R)-2,2-dimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 91330362 |
| Molecular Formula | C14H26O5S |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-[(1R,3R)-2,2-dimethyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutyl]ethanesulfonic acid |
| SMILES | CC([C@@H]1C[C@H](CC(=O)OC(C)(C)C)C1(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C14H26O5S/c1-9(20(16,17)18)11-7-10(14(11,5)6)8-12(15)19-13(2,3)4/h9-11H,7-8H2,1-6H3,(H,16,17,18)/t9?,10-,11+/m1/s1 |
| InChIKey | ZKHJADKJKNJDPW-ZOCYIJKUSA-N |
| XLogP | 2.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|