C13H26N2O3 — CID 107237358
tert-butyl N-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]carbamate (PubChem CID 107237358) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl N-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]carbamate.
| Compound Name | tert-butyl N-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]carbamate |
|---|---|
| PubChem CID | 107237358 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl N-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]carbamate |
| SMILES | CCOC1CC(NNC(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-7-17-10-8-9(13(10,5)6)14-15-11(16)18-12(2,3)4/h9-10,14H,7-8H2,1-6H3,(H,15,16) |
| InChIKey | DECSPWLOLPFRAB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|