About tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate
tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate (PubChem CID 81463231) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate.
Analyze tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate?
The IUPAC name of tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate (CID 81463231) is tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate.
What is the SMILES notation for tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate?
The canonical SMILES for tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate is CCOC1CC(NCC(=O)OC(C)(C)C)C1(C)C.
What is the InChIKey of tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate?
The InChIKey is QVDMGCDJKLBQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-7-17-11-8-10(14(11,5)6)15-9-12(16)18-13(2,3)4/h10-11,15H,7-9H2,1-6H3.
What are the key properties of tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate?
tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate has a molecular weight of 257.37 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]acetate is sourced from PubChem (CID 81463231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).