C14H22O3 — CID 54196861
butyl 1,5-dimethyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 54196861) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is butyl 1,5-dimethyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | butyl 1,5-dimethyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 54196861 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | butyl 1,5-dimethyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CCCCOC(=O)C1CC2(C)CC1(C)C1OC12 |
| InChI | InChI=1S/C14H22O3/c1-4-5-6-16-12(15)9-7-13(2)8-14(9,3)11-10(13)17-11/h9-11H,4-8H2,1-3H3 |
| InChIKey | PMKVKWITLOEPEF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|