C10H18N2OSe — CID 134860361
1-hydroxy-3-(isoselenocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine (PubChem CID 134860361) has the molecular formula C10H18N2OSe and a molecular weight of 261.23 g/mol. Its IUPAC name is 1-hydroxy-3-(isoselenocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine.
| Compound Name | 1-hydroxy-3-(isoselenocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 134860361 |
| Molecular Formula | C10H18N2OSe |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-hydroxy-3-(isoselenocyanatomethyl)-2,2,5,5-tetramethylpyrrolidine |
| SMILES | CC1(C)CC(CN=C=[Se])C(C)(C)N1O |
| InChI | InChI=1S/C10H18N2OSe/c1-9(2)5-8(6-11-7-14)10(3,4)12(9)13/h8,13H,5-6H2,1-4H3 |
| InChIKey | BHEJOGWKAZUGKU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|