C47H76N4O9 — CID 139317564
[2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-oxoethyl]-3,5-bis[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]phenyl] 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 139317564) has the molecular formula C47H76N4O9 and a molecular weight of 841.14 g/mol. Its IUPAC name is [2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-oxoethyl]-3,5-bis[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]phenyl] 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate.
| Compound Name | [2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-oxoethyl]-3,5-bis[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]phenyl] 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 139317564 |
| Molecular Formula | C47H76N4O9 |
| Molecular Weight | 841.14 g/mol |
| Exact Mass | 840.56 |
| IUPAC Name | [2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-oxoethyl]-3,5-bis[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]phenyl] 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
| SMILES | CC1(C)CC(C(=O)Oc2cc(OC(=O)C3CC(C)(C)NC(C)(C)C3)c(CC(=O)C3CC(C)(C)N(O)C(C)(C)C3)c(OC(=O)C3CC(C)(C)N(O)C(C)(C)C3)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C47H76N4O9/c1-40(2)20-29(21-41(3,4)48-40)37(53)58-32-17-35(59-38(54)30-22-42(5,6)49-43(7,8)23-30)33(19-34(52)28-24-44(9,10)50(56)45(11,12)25-28)36(18-32)60-39(55)31-26-46(13,14)51(57)47(15,16)27-31/h17-18,28-31,48-49,56-57H,19-27H2,1-16H3 |
| InChIKey | DBBMNSHIMQIUJT-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 166.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.14 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|