C27H56N4O4 — CID 166148930
N,N'-bis[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-N'-methylethane-1,2-diamine (PubChem CID 166148930) has the molecular formula C27H56N4O4 and a molecular weight of 500.77 g/mol. Its IUPAC name is N,N'-bis[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-N'-methylethane-1,2-diamine.
| Compound Name | N,N'-bis[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 166148930 |
| Molecular Formula | C27H56N4O4 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.43 |
| IUPAC Name | N,N'-bis[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCCOC1CC(C)(C)N(O)C(C)(C)C1)CCNCCCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C27H56N4O4/c1-24(2)18-22(19-25(3,4)30(24)32)34-16-10-12-28-13-15-29(9)14-11-17-35-23-20-26(5,6)31(33)27(7,8)21-23/h22-23,28,32-33H,10-21H2,1-9H3 |
| InChIKey | VXVVUPKCAVKPBD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|