C14H31N3O — CID 63234739
N-(3-methoxypropyl)-N'-methyl-N'-[(1-methylpiperidin-4-yl)methyl]ethane-1,2-diamine (PubChem CID 63234739) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-methyl-N'-[(1-methylpiperidin-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-(3-methoxypropyl)-N'-methyl-N'-[(1-methylpiperidin-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 63234739 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | N-(3-methoxypropyl)-N'-methyl-N'-[(1-methylpiperidin-4-yl)methyl]ethane-1,2-diamine |
| SMILES | COCCCNCCN(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C14H31N3O/c1-16-9-5-14(6-10-16)13-17(2)11-8-15-7-4-12-18-3/h14-15H,4-13H2,1-3H3 |
| InChIKey | AFDGZKRRQIAFCF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|