C11H24N2O — CID 166948035
N-(3-methoxypropyl)-N,1-dimethylpiperidin-4-amine (PubChem CID 166948035) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-(3-methoxypropyl)-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 166948035 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-(3-methoxypropyl)-N,1-dimethylpiperidin-4-amine |
| SMILES | COCCCN(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C11H24N2O/c1-12-8-5-11(6-9-12)13(2)7-4-10-14-3/h11H,4-10H2,1-3H3 |
| InChIKey | ZQNDKJXAUQGGCK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|