C12H26N2O — CID 166567303
(3S)-1-tert-butyl-N-(2-methoxyethyl)-N-methylpyrrolidin-3-amine (PubChem CID 166567303) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is (3S)-1-tert-butyl-N-(2-methoxyethyl)-N-methylpyrrolidin-3-amine.
| Compound Name | (3S)-1-tert-butyl-N-(2-methoxyethyl)-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 166567303 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | (3S)-1-tert-butyl-N-(2-methoxyethyl)-N-methylpyrrolidin-3-amine |
| SMILES | COCCN(C)[C@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H26N2O/c1-12(2,3)14-7-6-11(10-14)13(4)8-9-15-5/h11H,6-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | BBKRXKYFVIDJGZ-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |