C14H30N2O4 — CID 145359890
tert-butyl 3-[2-methoxyethyl(methyl)amino]pyrrolidine-1-carboxylate;methanol (PubChem CID 145359890) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is tert-butyl 3-[2-methoxyethyl(methyl)amino]pyrrolidine-1-carboxylate;methanol.
| Compound Name | tert-butyl 3-[2-methoxyethyl(methyl)amino]pyrrolidine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 145359890 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | tert-butyl 3-[2-methoxyethyl(methyl)amino]pyrrolidine-1-carboxylate;methanol |
| SMILES | CO.COCCN(C)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H26N2O3.CH4O/c1-13(2,3)18-12(16)15-7-6-11(10-15)14(4)8-9-17-5;1-2/h11H,6-10H2,1-5H3;2H,1H3 |
| InChIKey | JZCSKKCUWHUXKM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |