C15H27FN2O3 — CID 171505452
tert-butyl 3-[2-fluoroethyl(2-methylpropanoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 171505452) has the molecular formula C15H27FN2O3 and a molecular weight of 302.39 g/mol. Its IUPAC name is tert-butyl 3-[2-fluoroethyl(2-methylpropanoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-fluoroethyl(2-methylpropanoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171505452 |
| Molecular Formula | C15H27FN2O3 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl 3-[2-fluoroethyl(2-methylpropanoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)C(=O)N(CCF)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27FN2O3/c1-11(2)13(19)18(9-7-16)12-6-8-17(10-12)14(20)21-15(3,4)5/h11-12H,6-10H2,1-5H3 |
| InChIKey | NNPNIXWUODSUQU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |