C12H26N2 — CID 129088258
(3S)-1-tert-butyl-N,N-diethylpyrrolidin-3-amine (PubChem CID 129088258) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (3S)-1-tert-butyl-N,N-diethylpyrrolidin-3-amine.
| Compound Name | (3S)-1-tert-butyl-N,N-diethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 129088258 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (3S)-1-tert-butyl-N,N-diethylpyrrolidin-3-amine |
| SMILES | CCN(CC)[C@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H26N2/c1-6-13(7-2)11-8-9-14(10-11)12(3,4)5/h11H,6-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | OLCCAYMMMRVBSK-NSHDSACASA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |