C13H25NO — CID 175289125
4-[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 175289125) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 175289125 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | C/C=C/COC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H25NO/c1-6-7-8-15-11-9-12(2,3)14-13(4,5)10-11/h6-7,11,14H,8-10H2,1-5H3/b7-6+ |
| InChIKey | ZUWWUKPGOFABRQ-VOTSOKGWSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|