C20H42N2O2Si — CID 579977
dimethyl-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]silane (PubChem CID 579977) has the molecular formula C20H42N2O2Si and a molecular weight of 370.65 g/mol. Its IUPAC name is dimethyl-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]silane.
| Compound Name | dimethyl-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]silane |
|---|---|
| PubChem CID | 579977 |
| Molecular Formula | C20H42N2O2Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | dimethyl-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]silane |
| SMILES | CC1(C)CC(O[Si](C)(C)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C20H42N2O2Si/c1-17(2)11-15(12-18(3,4)21-17)23-25(9,10)24-16-13-19(5,6)22-20(7,8)14-16/h15-16,21-22H,11-14H2,1-10H3 |
| InChIKey | BOBNOXCLPCOMIK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|